ethyl 10-undecynoate


ethyl dec-9-yne-1-carboxylate; ethyl 10-undecynoate
CAS RN:[94030-75-8]
Formula:C13H22O2; 210.32 g/mol
InChiKey:RIINEWTVKLQWOS-UHFFFAOYSA-N
SMILES:CCOC(=O)CCCCCCCCC#C
Molecular structure of ethyl 10-undecynoate
Density:0.907 g/mL
Molar volume:232.0 mL/mol
Refractive index:1.445
Molecular refractive power:61.71 mL/mol
Surface tension:31.96 dyn/cm

Isomers

bornyl propionate
Molecular structure of bornyl propionate
λ-bornyl propionate
Molecular structure of l-bornyl propionate
trans-4-tert-butylcyclohexyl prop-2-enoate
Molecular structure of trans-4-tert-butylcyclohexyl prop-2-enoate
ethyl 10-undecynoate
Molecular structure of ethyl 10-undecynoate
geranyl propionate
Molecular structure of geranyl propionate
isobornyl propionate
Molecular structure of isobornyl propionate
linalyl propionate
Molecular structure of linalyl propionate
lyral
Molecular structure of lyral